C10H8F7NO3S — CID 129295016
1,1,2,2,3,3,3-heptafluoro-N-(4-methoxyphenyl)propane-1-sulfonamide (PubChem CID 129295016) has the molecular formula C10H8F7NO3S and a molecular weight of 355.23 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-(4-methoxyphenyl)propane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-(4-methoxyphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 129295016 |
| Molecular Formula | C10H8F7NO3S |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-(4-methoxyphenyl)propane-1-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F7NO3S/c1-21-7-4-2-6(3-5-7)18-22(19,20)10(16,17)8(11,12)9(13,14)15/h2-5,18H,1H3 |
| InChIKey | ADLGCKUUCSWECN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|