C9H8F5NO3S — CID 129295019
1,1,2,2,2-pentafluoro-N-(4-methoxyphenyl)ethanesulfonamide (PubChem CID 129295019) has the molecular formula C9H8F5NO3S and a molecular weight of 305.22 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoro-N-(4-methoxyphenyl)ethanesulfonamide.
| Compound Name | 1,1,2,2,2-pentafluoro-N-(4-methoxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 129295019 |
| Molecular Formula | C9H8F5NO3S |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 1,1,2,2,2-pentafluoro-N-(4-methoxyphenyl)ethanesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F5NO3S/c1-18-7-4-2-6(3-5-7)15-19(16,17)9(13,14)8(10,11)12/h2-5,15H,1H3 |
| InChIKey | UZAXDALIIKVTOK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|