About lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate
lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate (PubChem CID 175482443) has the molecular formula C9H9F3LiNO5S
and a molecular weight of 307.18 g/mol. Its IUPAC name is lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate.
Molecular Properties
| Compound Name | lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate |
| PubChem CID | 175482443 |
| Molecular Formula | C9H9F3LiNO5S |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate |
| SMILES | COc1ccc(OC(=O)NS(=O)(=O)C(F)(F)F)cc1.[H-].[Li+] |
| InChI | InChI=1S/C9H8F3NO5S.Li.H/c1-17-6-2-4-7(5-3-6)18-8(14)13-19(15,16)9(10,11)12;;/h2-5H,1H3,(H,13,14);;/q;+1;-1 |
| InChIKey | OGKWBPVNTMOBJG-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate?
The IUPAC name of lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate (CID 175482443) is lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate.
What is the SMILES notation for lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate?
The canonical SMILES for lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate is COc1ccc(OC(=O)NS(=O)(=O)C(F)(F)F)cc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate?
The InChIKey is OGKWBPVNTMOBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO5S.Li.H/c1-17-6-2-4-7(5-3-6)18-8(14)13-19(15,16)9(10,11)12;;/h2-5H,1H3,(H,13,14);;/q;+1;-1.
What are the key properties of lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate?
lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate has a molecular weight of 307.18 g/mol, XLogP of -1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;(4-methoxyphenyl) N-(trifluoromethylsulfonyl)carbamate is sourced from PubChem (CID 175482443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).