About lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate
lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate (PubChem CID 175482452) has the molecular formula C9H8F3LiO6S
and a molecular weight of 308.16 g/mol. Its IUPAC name is lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate |
| PubChem CID | 175482452 |
| Molecular Formula | C9H8F3LiO6S |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate |
| SMILES | COc1ccc(OC(=O)OS(=O)(=O)C(F)(F)F)cc1.[H-].[Li+] |
| InChI | InChI=1S/C9H7F3O6S.Li.H/c1-16-6-2-4-7(5-3-6)17-8(13)18-19(14,15)9(10,11)12;;/h2-5H,1H3;;/q;+1;-1 |
| InChIKey | GRWMYPVXBKZKHO-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate?
The IUPAC name of lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate (CID 175482452) is lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate.
What is the SMILES notation for lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate?
The canonical SMILES for lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate is COc1ccc(OC(=O)OS(=O)(=O)C(F)(F)F)cc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate?
The InChIKey is GRWMYPVXBKZKHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O6S.Li.H/c1-16-6-2-4-7(5-3-6)17-8(13)18-19(14,15)9(10,11)12;;/h2-5H,1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate?
lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate has a molecular weight of 308.16 g/mol, XLogP of -0.82, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;(4-methoxyphenoxy)carbonyl trifluoromethanesulfonate is sourced from PubChem (CID 175482452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).