C12H8F6O5S — CID 139647997
[1,1,1-trifluoro-4-(3-methoxyphenyl)-4-oxobut-2-en-2-yl] trifluoromethanesulfonate (PubChem CID 139647997) has the molecular formula C12H8F6O5S and a molecular weight of 378.25 g/mol. Its IUPAC name is [1,1,1-trifluoro-4-(3-methoxyphenyl)-4-oxobut-2-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [1,1,1-trifluoro-4-(3-methoxyphenyl)-4-oxobut-2-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139647997 |
| Molecular Formula | C12H8F6O5S |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | [1,1,1-trifluoro-4-(3-methoxyphenyl)-4-oxobut-2-en-2-yl] trifluoromethanesulfonate |
| SMILES | COc1cccc(C(=O)C=C(OS(=O)(=O)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F6O5S/c1-22-8-4-2-3-7(5-8)9(19)6-10(11(13,14)15)23-24(20,21)12(16,17)18/h2-6H,1H3 |
| InChIKey | XAKJHRCLJWUOAN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|