C17H15F2NO2 — CID 5428617
(E)-3-(3,4-difluoroanilino)-1-(3-methoxyphenyl)but-2-en-1-one (PubChem CID 5428617) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is (E)-3-(3,4-difluoroanilino)-1-(3-methoxyphenyl)but-2-en-1-one.
| Compound Name | (E)-3-(3,4-difluoroanilino)-1-(3-methoxyphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 5428617 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (E)-3-(3,4-difluoroanilino)-1-(3-methoxyphenyl)but-2-en-1-one |
| SMILES | COc1cccc(C(=O)/C=C(\C)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H15F2NO2/c1-11(20-13-6-7-15(18)16(19)10-13)8-17(21)12-4-3-5-14(9-12)22-2/h3-10,20H,1-2H3/b11-8+ |
| InChIKey | GVRIFUNZEILSHS-DHZHZOJOSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|