C9H9ClF3NO2 — CID 124638592
(1R)-1-chloro-2,2,2-trifluoro-1-(4-methoxyanilino)ethanol (PubChem CID 124638592) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is (1R)-1-chloro-2,2,2-trifluoro-1-(4-methoxyanilino)ethanol.
| Compound Name | (1R)-1-chloro-2,2,2-trifluoro-1-(4-methoxyanilino)ethanol |
|---|---|
| PubChem CID | 124638592 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (1R)-1-chloro-2,2,2-trifluoro-1-(4-methoxyanilino)ethanol |
| SMILES | COc1ccc(N[C@](O)(Cl)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9ClF3NO2/c1-16-7-4-2-6(3-5-7)14-8(10,15)9(11,12)13/h2-5,14-15H,1H3/t8-/m1/s1 |
| InChIKey | PSVKBYYCVONRIE-MRVPVSSYSA-N |
| XLogP | 2.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|