C16H16ClF3N2O — CID 24849881
4-chloro-2-[1,1,1-trifluoro-2-(4-methoxyanilino)propan-2-yl]aniline (PubChem CID 24849881) has the molecular formula C16H16ClF3N2O and a molecular weight of 344.76 g/mol. Its IUPAC name is 4-chloro-2-[1,1,1-trifluoro-2-(4-methoxyanilino)propan-2-yl]aniline.
| Compound Name | 4-chloro-2-[1,1,1-trifluoro-2-(4-methoxyanilino)propan-2-yl]aniline |
|---|---|
| PubChem CID | 24849881 |
| Molecular Formula | C16H16ClF3N2O |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-chloro-2-[1,1,1-trifluoro-2-(4-methoxyanilino)propan-2-yl]aniline |
| SMILES | COc1ccc(NC(C)(c2cc(Cl)ccc2N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16ClF3N2O/c1-15(16(18,19)20,13-9-10(17)3-8-14(13)21)22-11-4-6-12(23-2)7-5-11/h3-9,22H,21H2,1-2H3 |
| InChIKey | GANGPGWUDVMGIU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|