C11H10F6N2O2 — CID 177416514
(NE)-N-[3,3,3-trifluoro-2-(4-methoxyanilino)-2-(trifluoromethyl)propylidene]hydroxylamine (PubChem CID 177416514) has the molecular formula C11H10F6N2O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is (NE)-N-[3,3,3-trifluoro-2-(4-methoxyanilino)-2-(trifluoromethyl)propylidene]hydroxylamine.
| Compound Name | (NE)-N-[3,3,3-trifluoro-2-(4-methoxyanilino)-2-(trifluoromethyl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 177416514 |
| Molecular Formula | C11H10F6N2O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (NE)-N-[3,3,3-trifluoro-2-(4-methoxyanilino)-2-(trifluoromethyl)propylidene]hydroxylamine |
| SMILES | COc1ccc(NC(/C=N/O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F6N2O2/c1-21-8-4-2-7(3-5-8)19-9(6-18-20,10(12,13)14)11(15,16)17/h2-6,19-20H,1H3/b18-6+ |
| InChIKey | QROOYBHIIZRLNP-NGYBGAFCSA-N |
| XLogP | 3.43 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|