C11H14ClF2NO — CID 67832517
N-(4-chloro-4,4-difluorobutyl)-4-methoxyaniline (PubChem CID 67832517) has the molecular formula C11H14ClF2NO and a molecular weight of 249.69 g/mol. Its IUPAC name is N-(4-chloro-4,4-difluorobutyl)-4-methoxyaniline.
| Compound Name | N-(4-chloro-4,4-difluorobutyl)-4-methoxyaniline |
|---|---|
| PubChem CID | 67832517 |
| Molecular Formula | C11H14ClF2NO |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-(4-chloro-4,4-difluorobutyl)-4-methoxyaniline |
| SMILES | COc1ccc(NCCCC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C11H14ClF2NO/c1-16-10-5-3-9(4-6-10)15-8-2-7-11(12,13)14/h3-6,15H,2,7-8H2,1H3 |
| InChIKey | JJFRWZBVAMAYQB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|