C13H12F3NO — CID 115257711
6-methoxy-N-(2,2,2-trifluoroethyl)naphthalen-2-amine (PubChem CID 115257711) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 6-methoxy-N-(2,2,2-trifluoroethyl)naphthalen-2-amine.
| Compound Name | 6-methoxy-N-(2,2,2-trifluoroethyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 115257711 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 6-methoxy-N-(2,2,2-trifluoroethyl)naphthalen-2-amine |
| SMILES | COc1ccc2cc(NCC(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C13H12F3NO/c1-18-12-5-3-9-6-11(4-2-10(9)7-12)17-8-13(14,15)16/h2-7,17H,8H2,1H3 |
| InChIKey | ACUMNEJLZZMZOM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |