C16H20N2O — CID 115206803
N-cyclopropyl-N'-(6-methoxynaphthalen-2-yl)ethane-1,2-diamine (PubChem CID 115206803) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-cyclopropyl-N'-(6-methoxynaphthalen-2-yl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(6-methoxynaphthalen-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115206803 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-cyclopropyl-N'-(6-methoxynaphthalen-2-yl)ethane-1,2-diamine |
| SMILES | COc1ccc2cc(NCCNC3CC3)ccc2c1 |
| InChI | InChI=1S/C16H20N2O/c1-19-16-7-3-12-10-15(4-2-13(12)11-16)18-9-8-17-14-5-6-14/h2-4,7,10-11,14,17-18H,5-6,8-9H2,1H3 |
| InChIKey | DHCBHINJLWZLON-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|