C15H18N2 — CID 115206802
N-cyclopropyl-N'-naphthalen-2-ylethane-1,2-diamine (PubChem CID 115206802) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N-cyclopropyl-N'-naphthalen-2-ylethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-naphthalen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 115206802 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-cyclopropyl-N'-naphthalen-2-ylethane-1,2-diamine |
| SMILES | c1ccc2cc(NCCNC3CC3)ccc2c1 |
| InChI | InChI=1S/C15H18N2/c1-2-4-13-11-15(6-5-12(13)3-1)17-10-9-16-14-7-8-14/h1-6,11,14,16-17H,7-10H2 |
| InChIKey | FLKHFSGEUTYPPO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|