C13H11F3N2O2 — CID 86669821
6-methoxy-2-(2,2,2-trifluoroethylamino)quinoline-3-carbaldehyde (PubChem CID 86669821) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is 6-methoxy-2-(2,2,2-trifluoroethylamino)quinoline-3-carbaldehyde.
| Compound Name | 6-methoxy-2-(2,2,2-trifluoroethylamino)quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 86669821 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-methoxy-2-(2,2,2-trifluoroethylamino)quinoline-3-carbaldehyde |
| SMILES | COc1ccc2nc(NCC(F)(F)F)c(C=O)cc2c1 |
| InChI | InChI=1S/C13H11F3N2O2/c1-20-10-2-3-11-8(5-10)4-9(6-19)12(18-11)17-7-13(14,15)16/h2-6H,7H2,1H3,(H,17,18) |
| InChIKey | JHGTUQCBTCXURT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|