C13H11NO4S — CID 3731867
2-(3-formyl-6-methoxyquinolin-2-yl)sulfanylacetic acid (PubChem CID 3731867) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-(3-formyl-6-methoxyquinolin-2-yl)sulfanylacetic acid.
| Compound Name | 2-(3-formyl-6-methoxyquinolin-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 3731867 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-(3-formyl-6-methoxyquinolin-2-yl)sulfanylacetic acid |
| SMILES | COc1ccc2nc(SCC(=O)O)c(C=O)cc2c1 |
| InChI | InChI=1S/C13H11NO4S/c1-18-10-2-3-11-8(5-10)4-9(6-15)13(14-11)19-7-12(16)17/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | VDHAXZSRBIEISQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|