C12H9F3N2O3S — CID 21003786
2-[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetic acid (PubChem CID 21003786) has the molecular formula C12H9F3N2O3S and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetic acid.
| Compound Name | 2-[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 21003786 |
| Molecular Formula | C12H9F3N2O3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetic acid |
| SMILES | COc1ccc2c(SCC(=O)O)nc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C12H9F3N2O3S/c1-20-6-2-3-7-8(4-6)16-11(12(13,14)15)17-10(7)21-5-9(18)19/h2-4H,5H2,1H3,(H,18,19) |
| InChIKey | GECQKEFMNDJTSS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |