C18H16F3N3O — CID 21003694
7-methoxy-N-(2-phenylethyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 21003694) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 7-methoxy-N-(2-phenylethyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 7-methoxy-N-(2-phenylethyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21003694 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 7-methoxy-N-(2-phenylethyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COc1ccc2c(NCCc3ccccc3)nc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C18H16F3N3O/c1-25-13-7-8-14-15(11-13)23-17(18(19,20)21)24-16(14)22-10-9-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3,(H,22,23,24) |
| InChIKey | LSHDXWWGEIIOKN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |