C15H9F9O4S4 — CID 141340774
[5-(4-methoxyphenyl)sulfanylthiophen-2-yl]sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141340774) has the molecular formula C15H9F9O4S4 and a molecular weight of 552.48 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)sulfanylthiophen-2-yl]sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [5-(4-methoxyphenyl)sulfanylthiophen-2-yl]sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141340774 |
| Molecular Formula | C15H9F9O4S4 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.92 |
| IUPAC Name | [5-(4-methoxyphenyl)sulfanylthiophen-2-yl]sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc(Sc2ccc(SOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C15H9F9O4S4/c1-27-8-2-4-9(5-3-8)29-10-6-7-11(30-10)31-28-32(25,26)15(23,24)13(18,19)12(16,17)14(20,21)22/h2-7H,1H3 |
| InChIKey | OYPSUGZTNGGPNB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|