About [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate
[(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate (PubChem CID 139975020) has the molecular formula C13H22O4S2
and a molecular weight of 306.45 g/mol. Its IUPAC name is [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate.
Molecular Properties
| Compound Name | [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate |
| PubChem CID | 139975020 |
| Molecular Formula | C13H22O4S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OS(C)(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H22O4S2/c1-5-10-19(14,15)17-18(3,4)11-12-6-8-13(16-2)9-7-12/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | RWXSDJRKJCDWEI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate?
The IUPAC name of [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate (CID 139975020) is [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate.
What is the SMILES notation for [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate?
The canonical SMILES for [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate is CCCS(=O)(=O)OS(C)(C)Cc1ccc(OC)cc1.
What is the InChIKey of [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate?
The InChIKey is RWXSDJRKJCDWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4S2/c1-5-10-19(14,15)17-18(3,4)11-12-6-8-13(16-2)9-7-12/h6-9H,5,10-11H2,1-4H3.
What are the key properties of [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate?
[(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate has a molecular weight of 306.45 g/mol, XLogP of 2.93, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] propane-1-sulfonate is sourced from PubChem (CID 139975020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).