C8H9F9O3S — CID 12016773
4,4,5,5,6,6,7,7,7-nonafluoroheptyl methanesulfonate (PubChem CID 12016773) has the molecular formula C8H9F9O3S and a molecular weight of 356.21 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoroheptyl methanesulfonate.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoroheptyl methanesulfonate |
|---|---|
| PubChem CID | 12016773 |
| Molecular Formula | C8H9F9O3S |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoroheptyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9O3S/c1-21(18,19)20-4-2-3-5(9,10)6(11,12)7(13,14)8(15,16)17/h2-4H2,1H3 |
| InChIKey | ZYUIPJOZIQWZTM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|