C16H3F30NO4S — CID 18362311
2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetic acid (PubChem CID 18362311) has the molecular formula C16H3F30NO4S and a molecular weight of 875.21 g/mol. Its IUPAC name is 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetic acid.
| Compound Name | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 18362311 |
| Molecular Formula | C16H3F30NO4S |
| Molecular Weight | 875.21 g/mol |
| Exact Mass | 874.93 |
| IUPAC Name | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H3F30NO4S/c17-3(18,5(21,22)9(29,30)13(37,38)39)4(19,20)7(25,26)11(33,34)15(43,44)47(1-2(48)49)52(50,51)16(45,46)12(35,36)8(27,28)6(23,24)10(31,32)14(40,41)42/h1H2,(H,48,49) |
| InChIKey | ZTNNZHMYUSEJAK-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.21 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|