C10H6F13NO4S — CID 87232510
[1,2,2,2-tetrafluoro-1-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl] prop-2-enoate (PubChem CID 87232510) has the molecular formula C10H6F13NO4S and a molecular weight of 483.20 g/mol. Its IUPAC name is [1,2,2,2-tetrafluoro-1-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl] prop-2-enoate.
| Compound Name | [1,2,2,2-tetrafluoro-1-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 87232510 |
| Molecular Formula | C10H6F13NO4S |
| Molecular Weight | 483.20 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | [1,2,2,2-tetrafluoro-1-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(N(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F13NO4S/c1-3-4(25)28-10(23,8(18,19)20)24(2)29(26,27)9(21,22)6(13,14)5(11,12)7(15,16)17/h3H,1H2,2H3 |
| InChIKey | YBONDKSBRPACGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|