C11H3F18NO4S — CID 175011449
[1,1,2,2-tetrafluoro-2-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]ethyl] prop-2-enoate (PubChem CID 175011449) has the molecular formula C11H3F18NO4S and a molecular weight of 587.18 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-2-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]ethyl] prop-2-enoate.
| Compound Name | [1,1,2,2-tetrafluoro-2-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 175011449 |
| Molecular Formula | C11H3F18NO4S |
| Molecular Weight | 587.18 g/mol |
| Exact Mass | 586.95 |
| IUPAC Name | [1,1,2,2-tetrafluoro-2-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)N(F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H3F18NO4S/c1-2-3(31)34-10(25,26)9(23,24)30(29)35(32,33)11(27,28)7(18,19)5(14,15)4(12,13)6(16,17)8(20,21)22/h2H,1H2 |
| InChIKey | RVQQPNKSSJSFLG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.18 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|