C13H2F23NO6S — CID 87070158
(4S)-2,2,3,3,4-pentafluoro-4-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]pentanedioic acid (PubChem CID 87070158) has the molecular formula C13H2F23NO6S and a molecular weight of 737.18 g/mol. Its IUPAC name is (4S)-2,2,3,3,4-pentafluoro-4-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]pentanedioic acid.
| Compound Name | (4S)-2,2,3,3,4-pentafluoro-4-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 87070158 |
| Molecular Formula | C13H2F23NO6S |
| Molecular Weight | 737.18 g/mol |
| Exact Mass | 736.92 |
| IUPAC Name | (4S)-2,2,3,3,4-pentafluoro-4-[fluoro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]pentanedioic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)[C@@](F)(C(=O)O)N(F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H2F23NO6S/c14-3(15,1(38)39)5(17,18)4(16,2(40)41)37(36)44(42,43)13(34,35)11(29,30)9(25,26)7(21,22)6(19,20)8(23,24)10(27,28)12(31,32)33/h(H,38,39)(H,40,41)/t4-/m1/s1 |
| InChIKey | HFLXWLZPQHZKJR-SCSAIBSYSA-N |
| XLogP | 5.58 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.18 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|