C18H26O6 — CID 54320826
4-(2-carboxyprop-1-enyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)hepta-2,5-dienedioic acid (PubChem CID 54320826) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-(2-carboxyprop-1-enyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)hepta-2,5-dienedioic acid.
| Compound Name | 4-(2-carboxyprop-1-enyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)hepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 54320826 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-(2-carboxyprop-1-enyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)hepta-2,5-dienedioic acid |
| SMILES | CCC(C)(C)C(C=C(C)C(=O)O)(C=C(C)C(=O)O)C=C(C)C(=O)O |
| InChI | InChI=1S/C18H26O6/c1-7-17(5,6)18(8-11(2)14(19)20,9-12(3)15(21)22)10-13(4)16(23)24/h8-10H,7H2,1-6H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | SRNNPGANGRQTOJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|