C18H26O8 — CID 57320449
4-(2-carboxyprop-1-enyl)-4-(2,3-dihydroxy-3-methylbutan-2-yl)-2,6-dimethylhepta-2,5-dienedioic acid (PubChem CID 57320449) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-(2-carboxyprop-1-enyl)-4-(2,3-dihydroxy-3-methylbutan-2-yl)-2,6-dimethylhepta-2,5-dienedioic acid.
| Compound Name | 4-(2-carboxyprop-1-enyl)-4-(2,3-dihydroxy-3-methylbutan-2-yl)-2,6-dimethylhepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 57320449 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-(2-carboxyprop-1-enyl)-4-(2,3-dihydroxy-3-methylbutan-2-yl)-2,6-dimethylhepta-2,5-dienedioic acid |
| SMILES | CC(=CC(C=C(C)C(=O)O)(C=C(C)C(=O)O)C(C)(O)C(C)(C)O)C(=O)O |
| InChI | InChI=1S/C18H26O8/c1-10(13(19)20)7-18(8-11(2)14(21)22,9-12(3)15(23)24)17(6,26)16(4,5)25/h7-9,25-26H,1-6H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | OMFYRFONXLEESO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|