C11H10F10O3 — CID 91374425
6-(difluoromethyl)-5,5,7,7,7-pentafluoro-6-hydroxy-2,4-dimethyl-4-(trifluoromethyl)hept-2-enoic acid (PubChem CID 91374425) has the molecular formula C11H10F10O3 and a molecular weight of 380.18 g/mol. Its IUPAC name is 6-(difluoromethyl)-5,5,7,7,7-pentafluoro-6-hydroxy-2,4-dimethyl-4-(trifluoromethyl)hept-2-enoic acid.
| Compound Name | 6-(difluoromethyl)-5,5,7,7,7-pentafluoro-6-hydroxy-2,4-dimethyl-4-(trifluoromethyl)hept-2-enoic acid |
|---|---|
| PubChem CID | 91374425 |
| Molecular Formula | C11H10F10O3 |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 6-(difluoromethyl)-5,5,7,7,7-pentafluoro-6-hydroxy-2,4-dimethyl-4-(trifluoromethyl)hept-2-enoic acid |
| SMILES | CC(=CC(C)(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H10F10O3/c1-4(5(22)23)3-7(2,10(16,17)18)9(14,15)8(24,6(12)13)11(19,20)21/h3,6,24H,1-2H3,(H,22,23) |
| InChIKey | XKGZFYCJMPWLET-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|