C8H12O4 — CID 175503380
4-hydroxy-2,4-dimethyl-5-oxohex-2-enoic acid (PubChem CID 175503380) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 4-hydroxy-2,4-dimethyl-5-oxohex-2-enoic acid.
| Compound Name | 4-hydroxy-2,4-dimethyl-5-oxohex-2-enoic acid |
|---|---|
| PubChem CID | 175503380 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-hydroxy-2,4-dimethyl-5-oxohex-2-enoic acid |
| SMILES | CC(=O)C(C)(O)C=C(C)C(=O)O |
| InChI | InChI=1S/C8H12O4/c1-5(7(10)11)4-8(3,12)6(2)9/h4,12H,1-3H3,(H,10,11) |
| InChIKey | HPIMGLMRGMVVOG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|