C14H22O7 — CID 54389591
4-(1,3-dihydroxy-2-methylpropan-2-yl)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid (PubChem CID 54389591) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-(1,3-dihydroxy-2-methylpropan-2-yl)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid.
| Compound Name | 4-(1,3-dihydroxy-2-methylpropan-2-yl)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 54389591 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-(1,3-dihydroxy-2-methylpropan-2-yl)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid |
| SMILES | CC(=CC(C=C(C)C(=O)O)(CO)C(C)(CO)CO)C(=O)O |
| InChI | InChI=1S/C14H22O7/c1-9(11(18)19)4-14(8-17,5-10(2)12(20)21)13(3,6-15)7-16/h4-5,15-17H,6-8H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | VFRJNTFWRZLICH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|