C16H28O10 — CID 89407398
2-(2-hydroxyethoxy)ethanol;4-(2-hydroxyethoxy)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid (PubChem CID 89407398) has the molecular formula C16H28O10 and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;4-(2-hydroxyethoxy)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;4-(2-hydroxyethoxy)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 89407398 |
| Molecular Formula | C16H28O10 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;4-(2-hydroxyethoxy)-4-(hydroxymethyl)-2,6-dimethylhepta-2,5-dienedioic acid |
| SMILES | CC(=CC(C=C(C)C(=O)O)(CO)OCCO)C(=O)O.OCCOCCO |
| InChI | InChI=1S/C12H18O7.C4H10O3/c1-8(10(15)16)5-12(7-14,19-4-3-13)6-9(2)11(17)18;5-1-3-7-4-2-6/h5-6,13-14H,3-4,7H2,1-2H3,(H,15,16)(H,17,18);5-6H,1-4H2 |
| InChIKey | CVYZTBYQXAVHOI-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|