C14H11F15O3 — CID 151426100
6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-5-hydroxy-2,5-dimethyl-10-(trifluoromethyl)undec-2-enoic acid (PubChem CID 151426100) has the molecular formula C14H11F15O3 and a molecular weight of 512.21 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-5-hydroxy-2,5-dimethyl-10-(trifluoromethyl)undec-2-enoic acid.
| Compound Name | 6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-5-hydroxy-2,5-dimethyl-10-(trifluoromethyl)undec-2-enoic acid |
|---|---|
| PubChem CID | 151426100 |
| Molecular Formula | C14H11F15O3 |
| Molecular Weight | 512.21 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-5-hydroxy-2,5-dimethyl-10-(trifluoromethyl)undec-2-enoic acid |
| SMILES | CC(=CCC(C)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H11F15O3/c1-5(6(30)31)3-4-7(2,32)9(16,17)11(20,21)12(22,23)10(18,19)8(15,13(24,25)26)14(27,28)29/h3,32H,4H2,1-2H3,(H,30,31) |
| InChIKey | PBNVDGFGSJICAD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|