C11H11F7O4 — CID 146636057
(E)-5,5,6,6,7,7,7-heptafluoro-2-methylhept-2-enoic acid;prop-2-enoic acid (PubChem CID 146636057) has the molecular formula C11H11F7O4 and a molecular weight of 340.19 g/mol. Its IUPAC name is (E)-5,5,6,6,7,7,7-heptafluoro-2-methylhept-2-enoic acid;prop-2-enoic acid.
| Compound Name | (E)-5,5,6,6,7,7,7-heptafluoro-2-methylhept-2-enoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 146636057 |
| Molecular Formula | C11H11F7O4 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (E)-5,5,6,6,7,7,7-heptafluoro-2-methylhept-2-enoic acid;prop-2-enoic acid |
| SMILES | C/C(=C\CC(F)(F)C(F)(F)C(F)(F)F)C(=O)O.C=CC(=O)O |
| InChI | InChI=1S/C8H7F7O2.C3H4O2/c1-4(5(16)17)2-3-6(9,10)7(11,12)8(13,14)15;1-2-3(4)5/h2H,3H2,1H3,(H,16,17);2H,1H2,(H,4,5)/b4-2+; |
| InChIKey | RFALNFFMZVNGEK-VEELZWTKSA-N |
| XLogP | 3.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|