C8H8F6O2 — CID 87645960
(E)-6,6,6-trifluoro-2-methyl-5-(trifluoromethyl)hex-2-enoic acid (PubChem CID 87645960) has the molecular formula C8H8F6O2 and a molecular weight of 250.14 g/mol. Its IUPAC name is (E)-6,6,6-trifluoro-2-methyl-5-(trifluoromethyl)hex-2-enoic acid.
| Compound Name | (E)-6,6,6-trifluoro-2-methyl-5-(trifluoromethyl)hex-2-enoic acid |
|---|---|
| PubChem CID | 87645960 |
| Molecular Formula | C8H8F6O2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | (E)-6,6,6-trifluoro-2-methyl-5-(trifluoromethyl)hex-2-enoic acid |
| SMILES | C/C(=C\CC(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H8F6O2/c1-4(6(15)16)2-3-5(7(9,10)11)8(12,13)14/h2,5H,3H2,1H3,(H,15,16)/b4-2+ |
| InChIKey | XXJDUAICJLRCDJ-DUXPYHPUSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|