About 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid
5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid (PubChem CID 157146247) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid.
Molecular Properties
| Compound Name | 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid |
| PubChem CID | 157146247 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(=CCC(C)O)C(=O)O |
| InChI | InChI=1S/C7H12O3.C3H4O2/c1-5(7(9)10)3-4-6(2)8;1-2-3(4)5/h3,6,8H,4H2,1-2H3,(H,9,10);2H,1H2,(H,4,5) |
| InChIKey | AKSRWXLVYWSAOS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid?
The IUPAC name of 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid (CID 157146247) is 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid.
What is the SMILES notation for 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid?
The canonical SMILES for 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid is C=CC(=O)O.CC(=CCC(C)O)C(=O)O.
What is the InChIKey of 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid?
The InChIKey is AKSRWXLVYWSAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C3H4O2/c1-5(7(9)10)3-4-6(2)8;1-2-3(4)5/h3,6,8H,4H2,1-2H3,(H,9,10);2H,1H2,(H,4,5).
What are the key properties of 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid?
5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid has a molecular weight of 216.23 g/mol, XLogP of 1.05, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-methylhex-2-enoic acid;prop-2-enoic acid is sourced from PubChem (CID 157146247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).