C13H24O — CID 142868240
but-1-ene;(4E)-5,6-dimethylhepta-4,6-dien-2-ol (PubChem CID 142868240) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is but-1-ene;(4E)-5,6-dimethylhepta-4,6-dien-2-ol.
| Compound Name | but-1-ene;(4E)-5,6-dimethylhepta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 142868240 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | but-1-ene;(4E)-5,6-dimethylhepta-4,6-dien-2-ol |
| SMILES | C=C(C)/C(C)=C/CC(C)O.C=CCC |
| InChI | InChI=1S/C9H16O.C4H8/c1-7(2)8(3)5-6-9(4)10;1-3-4-2/h5,9-10H,1,6H2,2-4H3;3H,1,4H2,2H3/b8-5+; |
| InChIKey | NZSPDNLXSUKRAK-HAAWTFQLSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|