C7H11FO — CID 123543230
5-fluorohepta-4,6-dien-2-ol (PubChem CID 123543230) has the molecular formula C7H11FO and a molecular weight of 130.16 g/mol. Its IUPAC name is 5-fluorohepta-4,6-dien-2-ol.
| Compound Name | 5-fluorohepta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 123543230 |
| Molecular Formula | C7H11FO |
| Molecular Weight | 130.16 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 5-fluorohepta-4,6-dien-2-ol |
| SMILES | C=CC(F)=CCC(C)O |
| InChI | InChI=1S/C7H11FO/c1-3-7(8)5-4-6(2)9/h3,5-6,9H,1,4H2,2H3 |
| InChIKey | JLELKWHXTVWFOW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|