C13H19F — CID 143772459
(3E,6E)-3-fluoro-6,9-dimethyl-5-methylidenedeca-1,3,6-triene (PubChem CID 143772459) has the molecular formula C13H19F and a molecular weight of 194.29 g/mol. Its IUPAC name is (3E,6E)-3-fluoro-6,9-dimethyl-5-methylidenedeca-1,3,6-triene.
| Compound Name | (3E,6E)-3-fluoro-6,9-dimethyl-5-methylidenedeca-1,3,6-triene |
|---|---|
| PubChem CID | 143772459 |
| Molecular Formula | C13H19F |
| Molecular Weight | 194.29 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (3E,6E)-3-fluoro-6,9-dimethyl-5-methylidenedeca-1,3,6-triene |
| SMILES | C=C/C(F)=C\C(=C)/C(C)=C/CC(C)C |
| InChI | InChI=1S/C13H19F/c1-6-13(14)9-12(5)11(4)8-7-10(2)3/h6,8-10H,1,5,7H2,2-4H3/b11-8+,13-9+ |
| InChIKey | MHVAIAZCUOQGKH-BLTLMDCKSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|