C20H30 — CID 144789623
(3E,5S,8E)-2,5,9-trimethyl-6,10-dimethylidene-4-propan-2-yldodeca-1,3,8,11-tetraene (PubChem CID 144789623) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is (3E,5S,8E)-2,5,9-trimethyl-6,10-dimethylidene-4-propan-2-yldodeca-1,3,8,11-tetraene.
| Compound Name | (3E,5S,8E)-2,5,9-trimethyl-6,10-dimethylidene-4-propan-2-yldodeca-1,3,8,11-tetraene |
|---|---|
| PubChem CID | 144789623 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (3E,5S,8E)-2,5,9-trimethyl-6,10-dimethylidene-4-propan-2-yldodeca-1,3,8,11-tetraene |
| SMILES | C=CC(=C)/C(C)=C/CC(=C)[C@H](C)/C(=C/C(=C)C)C(C)C |
| InChI | InChI=1S/C20H30/c1-10-16(6)17(7)11-12-18(8)19(9)20(15(4)5)13-14(2)3/h10-11,13,15,19H,1-2,6,8,12H2,3-5,7,9H3/b17-11+,20-13+/t19-/m0/s1 |
| InChIKey | SYLMDPQAMKUZCH-JXDXXXKOSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|