C15H24 — CID 143375678
(3Z,5E)-2,4,8-trimethyl-5-propan-2-ylnona-1,3,5,7-tetraene (PubChem CID 143375678) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (3Z,5E)-2,4,8-trimethyl-5-propan-2-ylnona-1,3,5,7-tetraene.
| Compound Name | (3Z,5E)-2,4,8-trimethyl-5-propan-2-ylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143375678 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (3Z,5E)-2,4,8-trimethyl-5-propan-2-ylnona-1,3,5,7-tetraene |
| SMILES | C=C(C)/C=C(C)/C(=C/C=C(C)C)C(C)C |
| InChI | InChI=1S/C15H24/c1-11(2)8-9-15(13(5)6)14(7)10-12(3)4/h8-10,13H,3H2,1-2,4-7H3/b14-10-,15-9+ |
| InChIKey | ZNQSHNFVTGNZGL-KDEUEPBXSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|