C13H16 — CID 144950262
(3Z)-2,4,8-trimethyl-5-methylidenenona-1,3,8-trien-6-yne (PubChem CID 144950262) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is (3Z)-2,4,8-trimethyl-5-methylidenenona-1,3,8-trien-6-yne.
| Compound Name | (3Z)-2,4,8-trimethyl-5-methylidenenona-1,3,8-trien-6-yne |
|---|---|
| PubChem CID | 144950262 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (3Z)-2,4,8-trimethyl-5-methylidenenona-1,3,8-trien-6-yne |
| SMILES | C=C(C)C#CC(=C)/C(C)=C\C(=C)C |
| InChI | InChI=1S/C13H16/c1-10(2)7-8-12(5)13(6)9-11(3)4/h9H,1,3,5H2,2,4,6H3/b13-9- |
| InChIKey | XKDGSJANHIULBP-LCYFTJDESA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|