C7H12Rh — CID 175138892
2,4-dimethylpenta-1,3-diene;rhodium (PubChem CID 175138892) has the molecular formula C7H12Rh and a molecular weight of 199.08 g/mol. Its IUPAC name is 2,4-dimethylpenta-1,3-diene;rhodium.
| Compound Name | 2,4-dimethylpenta-1,3-diene;rhodium |
|---|---|
| PubChem CID | 175138892 |
| Molecular Formula | C7H12Rh |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 2,4-dimethylpenta-1,3-diene;rhodium |
| SMILES | C=C(C)C=C(C)C.[Rh] |
| InChI | InChI=1S/C7H12.Rh/c1-6(2)5-7(3)4;/h5H,1H2,2-4H3; |
| InChIKey | XVARFMPEDPLJBO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|