C11H17F — CID 170710017
(3E,5Z)-3-fluoro-6,7-dimethylnona-1,3,5-triene (PubChem CID 170710017) has the molecular formula C11H17F and a molecular weight of 168.25 g/mol. Its IUPAC name is (3E,5Z)-3-fluoro-6,7-dimethylnona-1,3,5-triene.
| Compound Name | (3E,5Z)-3-fluoro-6,7-dimethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 170710017 |
| Molecular Formula | C11H17F |
| Molecular Weight | 168.25 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3E,5Z)-3-fluoro-6,7-dimethylnona-1,3,5-triene |
| SMILES | C=C/C(F)=C\C=C(\C)C(C)CC |
| InChI | InChI=1S/C11H17F/c1-5-9(3)10(4)7-8-11(12)6-2/h6-9H,2,5H2,1,3-4H3/b10-7-,11-8+ |
| InChIKey | NYSLXZQZCDUNTG-BDLVGCLISA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|