C12H21FP2 — CID 170213454
[(4E,6E)-7-fluoro-5-phosphanylnona-4,6,8-trienyl]-propan-2-ylphosphane (PubChem CID 170213454) has the molecular formula C12H21FP2 and a molecular weight of 246.25 g/mol. Its IUPAC name is [(4E,6E)-7-fluoro-5-phosphanylnona-4,6,8-trienyl]-propan-2-ylphosphane.
| Compound Name | [(4E,6E)-7-fluoro-5-phosphanylnona-4,6,8-trienyl]-propan-2-ylphosphane |
|---|---|
| PubChem CID | 170213454 |
| Molecular Formula | C12H21FP2 |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [(4E,6E)-7-fluoro-5-phosphanylnona-4,6,8-trienyl]-propan-2-ylphosphane |
| SMILES | C=C/C(F)=C\C(P)=C/CCCPC(C)C |
| InChI | InChI=1S/C12H21FP2/c1-4-11(13)9-12(14)7-5-6-8-15-10(2)3/h4,7,9-10,15H,1,5-6,8,14H2,2-3H3/b11-9+,12-7+ |
| InChIKey | WTFGUWKQOOHDPA-DMXQEXBGSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|