C5H8FN — CID 143572818
(1Z)-2-fluoro-N-methylbuta-1,3-dien-1-amine (PubChem CID 143572818) has the molecular formula C5H8FN and a molecular weight of 101.12 g/mol. Its IUPAC name is (1Z)-2-fluoro-N-methylbuta-1,3-dien-1-amine.
| Compound Name | (1Z)-2-fluoro-N-methylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143572818 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | (1Z)-2-fluoro-N-methylbuta-1,3-dien-1-amine |
| SMILES | C=C/C(F)=C/NC |
| InChI | InChI=1S/C5H8FN/c1-3-5(6)4-7-2/h3-4,7H,1H2,2H3/b5-4- |
| InChIKey | SJKXHORALRVVGY-PLNGDYQASA-N |
| XLogP | 1.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|