C7H12FN — CID 169181661
(2E)-3-fluoro-N,N-dimethylpenta-2,4-dien-1-amine (PubChem CID 169181661) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is (2E)-3-fluoro-N,N-dimethylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-3-fluoro-N,N-dimethylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 169181661 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (2E)-3-fluoro-N,N-dimethylpenta-2,4-dien-1-amine |
| SMILES | C=C/C(F)=C\CN(C)C |
| InChI | InChI=1S/C7H12FN/c1-4-7(8)5-6-9(2)3/h4-5H,1,6H2,2-3H3/b7-5+ |
| InChIKey | RGGYCJZUKVQQDJ-FNORWQNLSA-N |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|