C11H14BrN — CID 6372024
(Z)-3-bromo-N,N-dimethyl-3-phenylprop-2-en-1-amine (PubChem CID 6372024) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is (Z)-3-bromo-N,N-dimethyl-3-phenylprop-2-en-1-amine.
| Compound Name | (Z)-3-bromo-N,N-dimethyl-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 6372024 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (Z)-3-bromo-N,N-dimethyl-3-phenylprop-2-en-1-amine |
| SMILES | CN(C)C/C=C(\Br)c1ccccc1 |
| InChI | InChI=1S/C11H14BrN/c1-13(2)9-8-11(12)10-6-4-3-5-7-10/h3-8H,9H2,1-2H3/b11-8- |
| InChIKey | LDJJCNFLMAYZKB-FLIBITNWSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |