C6H11P — CID 142203829
[(3E)-hexa-1,3-dien-3-yl]phosphane (PubChem CID 142203829) has the molecular formula C6H11P and a molecular weight of 114.13 g/mol. Its IUPAC name is [(3E)-hexa-1,3-dien-3-yl]phosphane.
| Compound Name | [(3E)-hexa-1,3-dien-3-yl]phosphane |
|---|---|
| PubChem CID | 142203829 |
| Molecular Formula | C6H11P |
| Molecular Weight | 114.13 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | [(3E)-hexa-1,3-dien-3-yl]phosphane |
| SMILES | C=C/C(P)=C\CC |
| InChI | InChI=1S/C6H11P/c1-3-5-6(7)4-2/h4-5H,2-3,7H2,1H3/b6-5+ |
| InChIKey | UGIGQDIQCYOLRF-AATRIKPKSA-N |
| XLogP | 2.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.13 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|