C26H28O9 — CID 70480131
3-(2-carboxyethenoxy)prop-2-enoic acid;diphenylmethanone;5-hydroxy-2-methylhex-2-enoic acid (PubChem CID 70480131) has the molecular formula C26H28O9 and a molecular weight of 484.50 g/mol. Its IUPAC name is 3-(2-carboxyethenoxy)prop-2-enoic acid;diphenylmethanone;5-hydroxy-2-methylhex-2-enoic acid.
| Compound Name | 3-(2-carboxyethenoxy)prop-2-enoic acid;diphenylmethanone;5-hydroxy-2-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 70480131 |
| Molecular Formula | C26H28O9 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-(2-carboxyethenoxy)prop-2-enoic acid;diphenylmethanone;5-hydroxy-2-methylhex-2-enoic acid |
| SMILES | CC(=CCC(C)O)C(=O)O.O=C(O)C=COC=CC(=O)O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C7H12O3.C6H6O5/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5(7(9)10)3-4-6(2)8;7-5(8)1-3-11-4-2-6(9)10/h1-10H;3,6,8H,4H2,1-2H3,(H,9,10);1-4H,(H,7,8)(H,9,10) |
| InChIKey | VRCHOEYYSOFYQT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|