C8H8F6O2 — CID 57042454
5,5,6,6,7,7-hexafluoro-2-methylhept-2-enoic acid (PubChem CID 57042454) has the molecular formula C8H8F6O2 and a molecular weight of 250.14 g/mol. Its IUPAC name is 5,5,6,6,7,7-hexafluoro-2-methylhept-2-enoic acid.
| Compound Name | 5,5,6,6,7,7-hexafluoro-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 57042454 |
| Molecular Formula | C8H8F6O2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 5,5,6,6,7,7-hexafluoro-2-methylhept-2-enoic acid |
| SMILES | CC(=CCC(F)(F)C(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C8H8F6O2/c1-4(5(15)16)2-3-7(11,12)8(13,14)6(9)10/h2,6H,3H2,1H3,(H,15,16) |
| InChIKey | SPHXDKQCKXUYKX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|