C8H14O5S — CID 173377204
2,5-dimethyl-5-sulfohex-2-enoic acid (PubChem CID 173377204) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is 2,5-dimethyl-5-sulfohex-2-enoic acid.
| Compound Name | 2,5-dimethyl-5-sulfohex-2-enoic acid |
|---|---|
| PubChem CID | 173377204 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2,5-dimethyl-5-sulfohex-2-enoic acid |
| SMILES | CC(=CCC(C)(C)S(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14O5S/c1-6(7(9)10)4-5-8(2,3)14(11,12)13/h4H,5H2,1-3H3,(H,9,10)(H,11,12,13) |
| InChIKey | JGOCTNLVNFSGKV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|